C31H26ClN3O8 — CID 84582762
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 84582762) has the molecular formula C31H26ClN3O8 and a molecular weight of 604.02 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 84582762 |
| Molecular Formula | C31H26ClN3O8 |
| Molecular Weight | 604.02 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | COc1cc(/C=C2/CCc3c2nc2ccccc2c3C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C31H26ClN3O8/c1-40-25-13-17(14-26(41-2)30(25)42-3)12-18-8-10-21-28(20-6-4-5-7-23(20)34-29(18)21)31(37)43-16-27(36)33-24-11-9-19(35(38)39)15-22(24)32/h4-7,9,11-15H,8,10,16H2,1-3H3,(H,33,36)/b18-12- |
| InChIKey | AMLPLOGRYUKLMU-PDGQHHTCSA-N |
| XLogP | 6.10 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.02 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|