C34H24ClN3O6 — CID 6536360
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] (3E)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 6536360) has the molecular formula C34H24ClN3O6 and a molecular weight of 606.03 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (3E)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (3E)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 6536360 |
| Molecular Formula | C34H24ClN3O6 |
| Molecular Weight | 606.03 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (3E)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)/C(=C/c1cccc(Oc3ccccc3)c1)CC2)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C34H24ClN3O6/c35-28-16-14-23(38(41)42)19-30(28)36-31(39)20-43-34(40)32-26-11-4-5-12-29(26)37-33-22(13-15-27(32)33)17-21-7-6-10-25(18-21)44-24-8-2-1-3-9-24/h1-12,14,16-19H,13,15,20H2,(H,36,39)/b22-17+ |
| InChIKey | JXAJXBRFCOQPRV-OQKWZONESA-N |
| XLogP | 7.87 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.03 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|