C30H22ClN3O7 — CID 4536755
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-(1,3-benzodioxol-5-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 4536755) has the molecular formula C30H22ClN3O7 and a molecular weight of 571.97 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-(1,3-benzodioxol-5-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-(1,3-benzodioxol-5-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 4536755 |
| Molecular Formula | C30H22ClN3O7 |
| Molecular Weight | 571.97 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-(1,3-benzodioxol-5-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)C(=Cc1ccc3c(c1)OCO3)CCC2)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C30H22ClN3O7/c31-22-10-9-19(34(37)38)14-24(22)32-27(35)15-39-30(36)28-20-5-1-2-7-23(20)33-29-18(4-3-6-21(28)29)12-17-8-11-25-26(13-17)41-16-40-25/h1-2,5,7-14H,3-4,6,15-16H2,(H,32,35) |
| InChIKey | GYIYEVWDVSUTTB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.97 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|