C29H20ClN3O7 — CID 5133073
[2-(5-chloro-2-nitroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 5133073) has the molecular formula C29H20ClN3O7 and a molecular weight of 557.95 g/mol. Its IUPAC name is [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 5133073 |
| Molecular Formula | C29H20ClN3O7 |
| Molecular Weight | 557.95 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)C(=Cc1ccc3c(c1)OCO3)CC2)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H20ClN3O7/c30-18-7-9-23(33(36)37)22(13-18)31-26(34)14-38-29(35)27-19-3-1-2-4-21(19)32-28-17(6-8-20(27)28)11-16-5-10-24-25(12-16)40-15-39-24/h1-5,7,9-13H,6,8,14-15H2,(H,31,34) |
| InChIKey | IHHVXVULHIGDCU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.95 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|