C29H22ClNO5 — CID 4276082
2-(2-chlorophenoxy)ethyl 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 4276082) has the molecular formula C29H22ClNO5 and a molecular weight of 499.95 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 4276082 |
| Molecular Formula | C29H22ClNO5 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 3-(1,3-benzodioxol-5-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | O=C(OCCOc1ccccc1Cl)c1c2c(nc3ccccc13)C(=Cc1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C29H22ClNO5/c30-22-6-2-4-8-24(22)33-13-14-34-29(32)27-20-5-1-3-7-23(20)31-28-19(10-11-21(27)28)15-18-9-12-25-26(16-18)36-17-35-25/h1-9,12,15-16H,10-11,13-14,17H2 |
| InChIKey | WYJATRMZRMAFOW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|