C26H27N3O3 — CID 76859124
3-(1,3-benzodioxol-5-ylmethylidene)-N-[3-(dimethylamino)propyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide (PubChem CID 76859124) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylidene)-N-[3-(dimethylamino)propyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylidene)-N-[3-(dimethylamino)propyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 76859124 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylidene)-N-[3-(dimethylamino)propyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1c2c(nc3ccccc13)C(=Cc1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C26H27N3O3/c1-29(2)13-5-12-27-26(30)24-19-6-3-4-7-21(19)28-25-18(9-10-20(24)25)14-17-8-11-22-23(15-17)32-16-31-22/h3-4,6-8,11,14-15H,5,9-10,12-13,16H2,1-2H3,(H,27,30) |
| InChIKey | RDEZHVAWXGTKIW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|