C27H22ClNO3S — CID 3276166
2-(2-chlorophenoxy)ethyl 4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 3276166) has the molecular formula C27H22ClNO3S and a molecular weight of 476.00 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 3276166 |
| Molecular Formula | C27H22ClNO3S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | O=C(OCCOc1ccccc1Cl)c1c2c(nc3ccccc13)C(=Cc1cccs1)CCC2 |
| InChI | InChI=1S/C27H22ClNO3S/c28-22-11-2-4-13-24(22)31-14-15-32-27(30)25-20-9-1-3-12-23(20)29-26-18(7-5-10-21(25)26)17-19-8-6-16-33-19/h1-4,6,8-9,11-13,16-17H,5,7,10,14-15H2 |
| InChIKey | HGZNORRZIJWNAG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|