C29H22BrN3O5 — CID 5233597
[2-(3-bromoanilino)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 5233597) has the molecular formula C29H22BrN3O5 and a molecular weight of 572.42 g/mol. Its IUPAC name is [2-(3-bromoanilino)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [2-(3-bromoanilino)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 5233597 |
| Molecular Formula | C29H22BrN3O5 |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | [2-(3-bromoanilino)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)C(=Cc1ccc([N+](=O)[O-])cc1)CCC2)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C29H22BrN3O5/c30-20-6-4-7-21(16-20)31-26(34)17-38-29(35)27-23-8-1-2-10-25(23)32-28-19(5-3-9-24(27)28)15-18-11-13-22(14-12-18)33(36)37/h1-2,4,6-8,10-16H,3,5,9,17H2,(H,31,34) |
| InChIKey | SYLHVYWUPUXHLZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|