C23H17N3O4 — CID 6143330
cyanomethyl (4E)-4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 6143330) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is cyanomethyl (4E)-4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | cyanomethyl (4E)-4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 6143330 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | cyanomethyl (4E)-4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | N#CCOC(=O)c1c2c(nc3ccccc13)/C(=C/c1ccc([N+](=O)[O-])cc1)CCC2 |
| InChI | InChI=1S/C23H17N3O4/c24-12-13-30-23(27)21-18-5-1-2-7-20(18)25-22-16(4-3-6-19(21)22)14-15-8-10-17(11-9-15)26(28)29/h1-2,5,7-11,14H,3-4,6,13H2/b16-14+ |
| InChIKey | FJXLIHAWHSAIDO-JQIJEIRASA-N |
| XLogP | 4.70 |
| TPSA | 106.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|