C32H31N3O5 — CID 4832048
[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 4832048) has the molecular formula C32H31N3O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 4832048 |
| Molecular Formula | C32H31N3O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | CCCn1c(C)cc(C(=O)COC(=O)c2c3c(nc4ccccc24)C(=Cc2ccc([N+](=O)[O-])cc2)CCC3)c1C |
| InChI | InChI=1S/C32H31N3O5/c1-4-16-34-20(2)17-27(21(34)3)29(36)19-40-32(37)30-25-9-5-6-11-28(25)33-31-23(8-7-10-26(30)31)18-22-12-14-24(15-13-22)35(38)39/h5-6,9,11-15,17-18H,4,7-8,10,16,19H2,1-3H3 |
| InChIKey | MTJGCOMIKFUFKB-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|