C27H20N2O5 — CID 3994071
(4-nitrophenyl)methyl 3-[(4-hydroxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 3994071) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[(4-hydroxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-[(4-hydroxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 3994071 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[(4-hydroxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)c1c2c(nc3ccccc13)C(=Cc1ccc(O)cc1)CC2 |
| InChI | InChI=1S/C27H20N2O5/c30-21-12-7-17(8-13-21)15-19-9-14-23-25(22-3-1-2-4-24(22)28-26(19)23)27(31)34-16-18-5-10-20(11-6-18)29(32)33/h1-8,10-13,15,30H,9,14,16H2 |
| InChIKey | MQMZODJUXKDUEE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|