C19H16N2O4 — CID 8824958
(4-nitrophenyl)methyl 2,4-dimethylquinoline-3-carboxylate (PubChem CID 8824958) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2,4-dimethylquinoline-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2,4-dimethylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8824958 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (4-nitrophenyl)methyl 2,4-dimethylquinoline-3-carboxylate |
| SMILES | Cc1nc2ccccc2c(C)c1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-12-16-5-3-4-6-17(16)20-13(2)18(12)19(22)25-11-14-7-9-15(10-8-14)21(23)24/h3-10H,11H2,1-2H3 |
| InChIKey | XGDBNZYAEIUGDC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|