C27H19N3O6 — CID 1424730
(4-nitrophenyl)methyl 4-methyl-3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate (PubChem CID 1424730) has the molecular formula C27H19N3O6 and a molecular weight of 481.46 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-methyl-3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate.
| Compound Name | (4-nitrophenyl)methyl 4-methyl-3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate |
|---|---|
| PubChem CID | 1424730 |
| Molecular Formula | C27H19N3O6 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (4-nitrophenyl)methyl 4-methyl-3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate |
| SMILES | Cc1ccc(C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1N1C(=O)c2c(C)nc3ccccc3c2C1=O |
| InChI | InChI=1S/C27H19N3O6/c1-15-7-10-18(27(33)36-14-17-8-11-19(12-9-17)30(34)35)13-22(15)29-25(31)23-16(2)28-21-6-4-3-5-20(21)24(23)26(29)32/h3-13H,14H2,1-2H3 |
| InChIKey | CHCUOKZWMXAUEK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 119.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|