C29H22N2O5 — CID 1427725
[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate (PubChem CID 1427725) has the molecular formula C29H22N2O5 and a molecular weight of 478.50 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate |
|---|---|
| PubChem CID | 1427725 |
| Molecular Formula | C29H22N2O5 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2cccc(N3C(=O)c4c(C)nc5ccccc5c4C3=O)c2)c1 |
| InChI | InChI=1S/C29H22N2O5/c1-16-11-12-17(2)22(13-16)24(32)15-36-29(35)19-7-6-8-20(14-19)31-27(33)25-18(3)30-23-10-5-4-9-21(23)26(25)28(31)34/h4-14H,15H2,1-3H3 |
| InChIKey | QZBNMYQHIACWOZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|