C25H16N2O5S — CID 1280572
(2-oxo-2-thiophen-2-ylethyl) 4-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate (PubChem CID 1280572) has the molecular formula C25H16N2O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 4-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 4-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate |
|---|---|
| PubChem CID | 1280572 |
| Molecular Formula | C25H16N2O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 4-(4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)benzoate |
| SMILES | Cc1nc2ccccc2c2c1C(=O)N(c1ccc(C(=O)OCC(=O)c3cccs3)cc1)C2=O |
| InChI | InChI=1S/C25H16N2O5S/c1-14-21-22(17-5-2-3-6-18(17)26-14)24(30)27(23(21)29)16-10-8-15(9-11-16)25(31)32-13-19(28)20-7-4-12-33-20/h2-12H,13H2,1H3 |
| InChIKey | JYGVKCBVTXYJDX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|