C29H24N2O5 — CID 3504635
(4-nitrophenyl)methyl 4-[(4-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 3504635) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[(4-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-[(4-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 3504635 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[(4-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | COc1ccc(C=C2CCCc3c2nc2ccccc2c3C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C29H24N2O5/c1-35-23-15-11-19(12-16-23)17-21-5-4-7-25-27(24-6-2-3-8-26(24)30-28(21)25)29(32)36-18-20-9-13-22(14-10-20)31(33)34/h2-3,6,8-17H,4-5,7,18H2,1H3 |
| InChIKey | XCXSYGILVPXLKT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|