C28H22N2O5 — CID 6531054
(3-nitrophenyl)methyl (3E)-3-[(4-methoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 6531054) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is (3-nitrophenyl)methyl (3E)-3-[(4-methoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | (3-nitrophenyl)methyl (3E)-3-[(4-methoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 6531054 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (3-nitrophenyl)methyl (3E)-3-[(4-methoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | COc1ccc(/C=C2\CCc3c2nc2ccccc2c3C(=O)OCc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H22N2O5/c1-34-22-12-9-18(10-13-22)15-20-11-14-24-26(23-7-2-3-8-25(23)29-27(20)24)28(31)35-17-19-5-4-6-21(16-19)30(32)33/h2-10,12-13,15-16H,11,14,17H2,1H3/b20-15+ |
| InChIKey | TWKCKOZBPSOCMY-HMMYKYKNSA-N |
| XLogP | 6.00 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|