C29H24N2O5 — CID 5041914
2-phenoxyethyl 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 5041914) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-phenoxyethyl 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | 2-phenoxyethyl 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 5041914 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-phenoxyethyl 4-[(4-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | O=C(OCCOc1ccccc1)c1c2c(nc3ccccc13)C(=Cc1ccc([N+](=O)[O-])cc1)CCC2 |
| InChI | InChI=1S/C29H24N2O5/c32-29(36-18-17-35-23-8-2-1-3-9-23)27-24-10-4-5-12-26(24)30-28-21(7-6-11-25(27)28)19-20-13-15-22(16-14-20)31(33)34/h1-5,8-10,12-16,19H,6-7,11,17-18H2 |
| InChIKey | BVVIPEZONNILDV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|