About 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate
2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate (PubChem CID 2652516) has the molecular formula C21H19NO3
and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate.
Molecular Properties
| Compound Name | 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
| PubChem CID | 2652516 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
| SMILES | O=C(OCCOc1ccccc1)c1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C21H19NO3/c23-21(25-14-13-24-15-7-2-1-3-8-15)20-16-9-4-5-11-18(16)22-19-12-6-10-17(19)20/h1-5,7-9,11H,6,10,12-14H2 |
| InChIKey | PCDJVDRVAYVMFK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate?
The IUPAC name of 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate (CID 2652516) is 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate.
What is the SMILES notation for 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate?
The canonical SMILES for 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate is O=C(OCCOc1ccccc1)c1c2c(nc3ccccc13)CCC2.
What is the InChIKey of 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate?
The InChIKey is PCDJVDRVAYVMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO3/c23-21(25-14-13-24-15-7-2-1-3-8-15)20-16-9-4-5-11-18(16)22-19-12-6-10-17(19)20/h1-5,7-9,11H,6,10,12-14H2.
What are the key properties of 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate?
2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate has a molecular weight of 333.39 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate is sourced from PubChem (CID 2652516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).