C24H24FNO3 — CID 7276947
3-(4-fluorophenoxy)propyl 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate (PubChem CID 7276947) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate.
| Compound Name | 3-(4-fluorophenoxy)propyl 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
|---|---|
| PubChem CID | 7276947 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
| SMILES | O=C(OCCCOc1ccc(F)cc1)c1c2c(nc3ccccc13)CCCCC2 |
| InChI | InChI=1S/C24H24FNO3/c25-17-11-13-18(14-12-17)28-15-6-16-29-24(27)23-19-7-2-1-3-9-21(19)26-22-10-5-4-8-20(22)23/h4-5,8,10-14H,1-3,6-7,9,15-16H2 |
| InChIKey | CKJNPQQGRSWONH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|