C27H31NO4 — CID 3658736
2-(4-methoxyphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 3658736) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 3658736 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | COc1ccc(OCCOC(=O)c2c3c(nc4ccccc24)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C27H31NO4/c1-27(2,3)18-9-14-24-22(17-18)25(21-7-5-6-8-23(21)28-24)26(29)32-16-15-31-20-12-10-19(30-4)11-13-20/h5-8,10-13,18H,9,14-17H2,1-4H3 |
| InChIKey | DROKTEMJPXEGIR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|