C27H31NO3 — CID 3272240
2-(4-methylphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 3272240) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | 2-(4-methylphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 3272240 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | Cc1ccc(OCCOC(=O)c2c3c(nc4ccccc24)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C27H31NO3/c1-18-9-12-20(13-10-18)30-15-16-31-26(29)25-21-7-5-6-8-23(21)28-24-14-11-19(17-22(24)25)27(2,3)4/h5-10,12-13,19H,11,14-17H2,1-4H3 |
| InChIKey | ZLDBNZZLPWZXFM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|