C26H27IN2O3 — CID 23969723
[2-(2-iodoanilino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23969723) has the molecular formula C26H27IN2O3 and a molecular weight of 542.42 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23969723 |
| Molecular Formula | C26H27IN2O3 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC(C)(C)C1CCc2nc3ccccc3c(C(=O)OCC(=O)Nc3ccccc3I)c2C1 |
| InChI | InChI=1S/C26H27IN2O3/c1-26(2,3)16-12-13-21-18(14-16)24(17-8-4-6-10-20(17)28-21)25(31)32-15-23(30)29-22-11-7-5-9-19(22)27/h4-11,16H,12-15H2,1-3H3,(H,29,30) |
| InChIKey | YTEGDQICXUUKIU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|