C28H30N2O5 — CID 23881714
[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23881714) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23881714 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC(C)(C)C1CCc2nc3ccccc3c(C(=O)OCC(=O)Nc3ccc4c(c3)OCCO4)c2C1 |
| InChI | InChI=1S/C28H30N2O5/c1-28(2,3)17-8-10-22-20(14-17)26(19-6-4-5-7-21(19)30-22)27(32)35-16-25(31)29-18-9-11-23-24(15-18)34-13-12-33-23/h4-7,9,11,15,17H,8,10,12-14,16H2,1-3H3,(H,29,31) |
| InChIKey | PAOOJSNBMDXZOF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |