C25H31N3O4 — CID 42948931
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 42948931) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 42948931 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC1(C)NC(=O)N(CCOC(=O)c2c3c(nc4ccccc24)CCC(C(C)(C)C)C3)C1=O |
| InChI | InChI=1S/C25H31N3O4/c1-24(2,3)15-10-11-19-17(14-15)20(16-8-6-7-9-18(16)26-19)21(29)32-13-12-28-22(30)25(4,5)27-23(28)31/h6-9,15H,10-14H2,1-5H3,(H,27,31) |
| InChIKey | ORURNKYNSBELCM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|