C28H23N3O5S — CID 91659331
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 91659331) has the molecular formula C28H23N3O5S and a molecular weight of 513.58 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 91659331 |
| Molecular Formula | C28H23N3O5S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)/C(=C\c1cccc([N+](=O)[O-])c1)CCC2)NCc1cccs1 |
| InChI | InChI=1S/C28H23N3O5S/c32-25(29-16-21-9-5-13-37-21)17-36-28(33)26-22-10-1-2-12-24(22)30-27-19(7-4-11-23(26)27)14-18-6-3-8-20(15-18)31(34)35/h1-3,5-6,8-10,12-15H,4,7,11,16-17H2,(H,29,32)/b19-14- |
| InChIKey | RDBPJYXIQAUVRI-RGEXLXHISA-N |
| XLogP | 5.55 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|