C33H29ClN4O7S — CID 99710870
[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 99710870) has the molecular formula C33H29ClN4O7S and a molecular weight of 661.14 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 99710870 |
| Molecular Formula | C33H29ClN4O7S |
| Molecular Weight | 661.14 g/mol |
| Exact Mass | 660.14 |
| IUPAC Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (4Z)-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)c1c2c(nc3ccccc13)/C(=C\c1cccc([N+](=O)[O-])c1)CCC2 |
| InChI | InChI=1S/C33H29ClN4O7S/c34-24-11-13-26(14-12-24)46(43,44)37-17-15-36(16-18-37)30(39)21-45-33(40)31-27-8-1-2-10-29(27)35-32-23(6-4-9-28(31)32)19-22-5-3-7-25(20-22)38(41)42/h1-3,5,7-8,10-14,19-20H,4,6,9,15-18,21H2/b23-19- |
| InChIKey | SZHNRARFPYGVAR-NMWGTECJSA-N |
| XLogP | 5.36 |
| TPSA | 140.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.14 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|