C35H27N3O7 — CID 98408782
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] (3Z)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 98408782) has the molecular formula C35H27N3O7 and a molecular weight of 601.62 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] (3Z)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] (3Z)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 98408782 |
| Molecular Formula | C35H27N3O7 |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] (3Z)-3-[(3-phenoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2c3c(nc4ccccc24)/C(=C\c2cccc(Oc4ccccc4)c2)CC3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H27N3O7/c1-43-25-15-17-30(31(20-25)38(41)42)36-32(39)21-44-35(40)33-27-12-5-6-13-29(27)37-34-23(14-16-28(33)34)18-22-8-7-11-26(19-22)45-24-9-3-2-4-10-24/h2-13,15,17-20H,14,16,21H2,1H3,(H,36,39)/b23-18- |
| InChIKey | ADLYPUIDXPFZJO-NKFKGCMQSA-N |
| XLogP | 7.23 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|