C22H21FN2O3 — CID 8668121
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate (PubChem CID 8668121) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8668121 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
| SMILES | CCc1nc2ccccc2c(C)c1C(=O)OCC(=O)NCc1ccccc1F |
| InChI | InChI=1S/C22H21FN2O3/c1-3-18-21(14(2)16-9-5-7-11-19(16)25-18)22(27)28-13-20(26)24-12-15-8-4-6-10-17(15)23/h4-11H,3,12-13H2,1-2H3,(H,24,26) |
| InChIKey | GALMRVKGHUPUEV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |