C22H20FNO4 — CID 8661348
ethyl 2-[[2-(2-fluorophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate (PubChem CID 8661348) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is ethyl 2-[[2-(2-fluorophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-fluorophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8661348 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | ethyl 2-[[2-(2-fluorophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(COC(=O)Cc2ccccc2F)nc2ccccc2c1C |
| InChI | InChI=1S/C22H20FNO4/c1-3-27-22(26)21-14(2)16-9-5-7-11-18(16)24-19(21)13-28-20(25)12-15-8-4-6-10-17(15)23/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | PZGBKEPEVPYJQP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |