C22H22N2O4 — CID 55994724
ethyl 4-methyl-2-[[2-(6-methyl-3-pyridinyl)acetyl]oxymethyl]quinoline-3-carboxylate (PubChem CID 55994724) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[2-(6-methyl-3-pyridinyl)acetyl]oxymethyl]quinoline-3-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[2-(6-methyl-3-pyridinyl)acetyl]oxymethyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 55994724 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | ethyl 4-methyl-2-[[2-(6-methyl-3-pyridinyl)acetyl]oxymethyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(COC(=O)Cc2ccc(C)nc2)nc2ccccc2c1C |
| InChI | InChI=1S/C22H22N2O4/c1-4-27-22(26)21-15(3)17-7-5-6-8-18(17)24-19(21)13-28-20(25)11-16-10-9-14(2)23-12-16/h5-10,12H,4,11,13H2,1-3H3 |
| InChIKey | LOLDGUVKFYMGIE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |