C24H24N2O5 — CID 8611562
ethyl 2-[[2-(4-acetamidophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate (PubChem CID 8611562) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl 2-[[2-(4-acetamidophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-acetamidophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8611562 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl 2-[[2-(4-acetamidophenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(COC(=O)Cc2ccc(NC(C)=O)cc2)nc2ccccc2c1C |
| InChI | InChI=1S/C24H24N2O5/c1-4-30-24(29)23-15(2)19-7-5-6-8-20(19)26-21(23)14-31-22(28)13-17-9-11-18(12-10-17)25-16(3)27/h5-12H,4,13-14H2,1-3H3,(H,25,27) |
| InChIKey | TWMNECBFUFSGDA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |