C23H22FNO5 — CID 8667374
ethyl 2-[[2-(3-fluoro-4-methoxyphenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate (PubChem CID 8667374) has the molecular formula C23H22FNO5 and a molecular weight of 411.43 g/mol. Its IUPAC name is ethyl 2-[[2-(3-fluoro-4-methoxyphenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-fluoro-4-methoxyphenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8667374 |
| Molecular Formula | C23H22FNO5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | ethyl 2-[[2-(3-fluoro-4-methoxyphenyl)acetyl]oxymethyl]-4-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(COC(=O)Cc2ccc(OC)c(F)c2)nc2ccccc2c1C |
| InChI | InChI=1S/C23H22FNO5/c1-4-29-23(27)22-14(2)16-7-5-6-8-18(16)25-19(22)13-30-21(26)12-15-9-10-20(28-3)17(24)11-15/h5-11H,4,12-13H2,1-3H3 |
| InChIKey | UNNSRYLWURFTJI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |