C21H21NO5S — CID 55590399
ethyl 4-methyl-2-[(4-methylsulfonylphenoxy)methyl]quinoline-3-carboxylate (PubChem CID 55590399) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(4-methylsulfonylphenoxy)methyl]quinoline-3-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(4-methylsulfonylphenoxy)methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 55590399 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | ethyl 4-methyl-2-[(4-methylsulfonylphenoxy)methyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(COc2ccc(S(C)(=O)=O)cc2)nc2ccccc2c1C |
| InChI | InChI=1S/C21H21NO5S/c1-4-26-21(23)20-14(2)17-7-5-6-8-18(17)22-19(20)13-27-15-9-11-16(12-10-15)28(3,24)25/h5-12H,4,13H2,1-3H3 |
| InChIKey | STHSCYFQAAGNCY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |