C22H25NO5 — CID 7874648
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 7874648) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 7874648 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)c1ccc(CCCNC(C)=O)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-3-27-21-9-5-4-8-19(21)22(26)28-15-20(25)18-12-10-17(11-13-18)7-6-14-23-16(2)24/h4-5,8-13H,3,6-7,14-15H2,1-2H3,(H,23,24) |
| InChIKey | LMMRPHMCEXXMSN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|