C15H23F3O6S2 — CID 175782295
sulfane;1,1,2-trifluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonic acid (PubChem CID 175782295) has the molecular formula C15H23F3O6S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is sulfane;1,1,2-trifluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonic acid.
| Compound Name | sulfane;1,1,2-trifluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 175782295 |
| Molecular Formula | C15H23F3O6S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | sulfane;1,1,2-trifluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonic acid |
| SMILES | O=C(OCCC(F)C(F)(F)S(=O)(=O)O)C12CC3CC(CC(O)(C3)C1)C2.S |
| InChI | InChI=1S/C15H21F3O6S.H2S/c16-11(15(17,18)25(21,22)23)1-2-24-12(19)13-4-9-3-10(5-13)7-14(20,6-9)8-13;/h9-11,20H,1-8H2,(H,21,22,23);1H2 |
| InChIKey | ZNMHGTSJSGHGMA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|