C19H23F7O7S — CID 170545452
1,1,2-trifluoro-4-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carbonyl)oxybutane-1-sulfonic acid (PubChem CID 170545452) has the molecular formula C19H23F7O7S and a molecular weight of 528.44 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carbonyl)oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-4-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carbonyl)oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 170545452 |
| Molecular Formula | C19H23F7O7S |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 1,1,2-trifluoro-4-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carbonyl)oxybutane-1-sulfonic acid |
| SMILES | O=C(OCCC(F)C(F)(F)S(=O)(=O)O)C12CC3CC(C1)C1(OCC(F)(F)C(F)(F)CO1)C(C3)C2 |
| InChI | InChI=1S/C19H23F7O7S/c20-13(19(25,26)34(28,29)30)1-2-31-14(27)15-5-10-3-11(6-15)18(12(4-10)7-15)32-8-16(21,22)17(23,24)9-33-18/h10-13H,1-9H2,(H,28,29,30) |
| InChIKey | GYPPGNZBBVCGKH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|