C17H23F3O7S — CID 122692800
4-[2-(adamantane-1-carbonyloxy)acetyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid (PubChem CID 122692800) has the molecular formula C17H23F3O7S and a molecular weight of 428.43 g/mol. Its IUPAC name is 4-[2-(adamantane-1-carbonyloxy)acetyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid.
| Compound Name | 4-[2-(adamantane-1-carbonyloxy)acetyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 122692800 |
| Molecular Formula | C17H23F3O7S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 4-[2-(adamantane-1-carbonyloxy)acetyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)OCCC(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H23F3O7S/c18-13(17(19,20)28(23,24)25)1-2-26-14(21)9-27-15(22)16-6-10-3-11(7-16)5-12(4-10)8-16/h10-13H,1-9H2,(H,23,24,25) |
| InChIKey | RYGVRXXOZBKKLC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|