C16H19F5O6S — CID 118861919
1,1-difluoro-4-(4-oxoadamantane-1-carbonyl)oxy-2-(trifluoromethyl)butane-1-sulfonic acid (PubChem CID 118861919) has the molecular formula C16H19F5O6S and a molecular weight of 434.38 g/mol. Its IUPAC name is 1,1-difluoro-4-(4-oxoadamantane-1-carbonyl)oxy-2-(trifluoromethyl)butane-1-sulfonic acid.
| Compound Name | 1,1-difluoro-4-(4-oxoadamantane-1-carbonyl)oxy-2-(trifluoromethyl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 118861919 |
| Molecular Formula | C16H19F5O6S |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1,1-difluoro-4-(4-oxoadamantane-1-carbonyl)oxy-2-(trifluoromethyl)butane-1-sulfonic acid |
| SMILES | O=C1C2CC3CC1CC(C(=O)OCCC(C(F)(F)F)C(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C16H19F5O6S/c17-15(18,19)11(16(20,21)28(24,25)26)1-2-27-13(23)14-5-8-3-9(6-14)12(22)10(4-8)7-14/h8-11H,1-7H2,(H,24,25,26) |
| InChIKey | SQWYRZGRGNUDPV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|