C19H24F2O5 — CID 122501794
[2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] 4-oxoadamantane-1-carboxylate (PubChem CID 122501794) has the molecular formula C19H24F2O5 and a molecular weight of 370.39 g/mol. Its IUPAC name is [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] 4-oxoadamantane-1-carboxylate.
| Compound Name | [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] 4-oxoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 122501794 |
| Molecular Formula | C19H24F2O5 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2,2-difluoro-4-(2-methylprop-2-enoyloxy)butyl] 4-oxoadamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)COC(=O)C12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C19H24F2O5/c1-11(2)16(23)25-4-3-19(20,21)10-26-17(24)18-7-12-5-13(8-18)15(22)14(6-12)9-18/h12-14H,1,3-10H2,2H3 |
| InChIKey | FIUSVGAGRKPDQG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|