C21H25F3O8 — CID 121355182
[1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 5-oxo-4-oxatricyclo[4.3.1.13,8]undecane-1-carboxylate (PubChem CID 121355182) has the molecular formula C21H25F3O8 and a molecular weight of 462.42 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 5-oxo-4-oxatricyclo[4.3.1.13,8]undecane-1-carboxylate.
| Compound Name | [1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 5-oxo-4-oxatricyclo[4.3.1.13,8]undecane-1-carboxylate |
|---|---|
| PubChem CID | 121355182 |
| Molecular Formula | C21H25F3O8 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 5-oxo-4-oxatricyclo[4.3.1.13,8]undecane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(C)(OC(=O)C12CC3CC(C1)OC(=O)C(C3)C2)C(F)(F)F |
| InChI | InChI=1S/C21H25F3O8/c1-11(2)15(25)29-4-5-30-17(27)19(3,21(22,23)24)32-18(28)20-8-12-6-13(9-20)16(26)31-14(7-12)10-20/h12-14H,1,4-10H2,2-3H3 |
| InChIKey | WWTHZAVSGYXIAL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|