C10H9F6O5- — CID 162509327
1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-olate (PubChem CID 162509327) has the molecular formula C10H9F6O5- and a molecular weight of 323.17 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-olate.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-olate |
|---|---|
| PubChem CID | 162509327 |
| Molecular Formula | C10H9F6O5- |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-olate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C([O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F6O5/c1-5(2)6(17)20-3-4-21-7(18)8(19,9(11,12)13)10(14,15)16/h1,3-4H2,2H3/q-1 |
| InChIKey | BPMYKLZCIPDIBL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|