C11H16F2O4 — CID 88573524
3-(2-methylprop-2-enoyloxy)propyl 2,2-difluorobutanoate (PubChem CID 88573524) has the molecular formula C11H16F2O4 and a molecular weight of 250.24 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)propyl 2,2-difluorobutanoate.
| Compound Name | 3-(2-methylprop-2-enoyloxy)propyl 2,2-difluorobutanoate |
|---|---|
| PubChem CID | 88573524 |
| Molecular Formula | C11H16F2O4 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)propyl 2,2-difluorobutanoate |
| SMILES | C=C(C)C(=O)OCCCOC(=O)C(F)(F)CC |
| InChI | InChI=1S/C11H16F2O4/c1-4-11(12,13)10(15)17-7-5-6-16-9(14)8(2)3/h2,4-7H2,1,3H3 |
| InChIKey | FKPMFUFRGTWQKU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|