C8H7F6O3- — CID 164845166
1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoxycarbonyl)propan-2-olate (PubChem CID 164845166) has the molecular formula C8H7F6O3- and a molecular weight of 265.13 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoxycarbonyl)propan-2-olate.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoxycarbonyl)propan-2-olate |
|---|---|
| PubChem CID | 164845166 |
| Molecular Formula | C8H7F6O3- |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoxycarbonyl)propan-2-olate |
| SMILES | C=C(C)COC(=O)C([O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7F6O3/c1-4(2)3-17-5(15)6(16,7(9,10)11)8(12,13)14/h1,3H2,2H3/q-1 |
| InChIKey | DWXGZJIZEVNEEE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|