C18H30O5 — CID 88827992
[2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoyl] 2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoate (PubChem CID 88827992) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoyl] 2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoate.
| Compound Name | [2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoyl] 2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoate |
|---|---|
| PubChem CID | 88827992 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoyl] 2,2-dimethyl-3-(2-methylprop-2-enoxy)propanoate |
| SMILES | C=C(C)COCC(C)(C)C(=O)OC(=O)C(C)(C)COCC(=C)C |
| InChI | InChI=1S/C18H30O5/c1-13(2)9-21-11-17(5,6)15(19)23-16(20)18(7,8)12-22-10-14(3)4/h1,3,9-12H2,2,4-8H3 |
| InChIKey | WOPJIZXOFWXUNR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|