C18H38OSi — CID 173259356
[2-methyl-1-(2-methylprop-2-enoxy)propan-2-yl]-di(pentan-3-yl)silane (PubChem CID 173259356) has the molecular formula C18H38OSi and a molecular weight of 298.59 g/mol. Its IUPAC name is [2-methyl-1-(2-methylprop-2-enoxy)propan-2-yl]-di(pentan-3-yl)silane.
| Compound Name | [2-methyl-1-(2-methylprop-2-enoxy)propan-2-yl]-di(pentan-3-yl)silane |
|---|---|
| PubChem CID | 173259356 |
| Molecular Formula | C18H38OSi |
| Molecular Weight | 298.59 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | [2-methyl-1-(2-methylprop-2-enoxy)propan-2-yl]-di(pentan-3-yl)silane |
| SMILES | C=C(C)COCC(C)(C)[SiH](C(CC)CC)C(CC)CC |
| InChI | InChI=1S/C18H38OSi/c1-9-16(10-2)20(17(11-3)12-4)18(7,8)14-19-13-15(5)6/h16-17,20H,5,9-14H2,1-4,6-8H3 |
| InChIKey | ATKLQGKXVBMSTM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|