C15H28O4 — CID 58715900
[2,2-dimethyl-3-(2-methylprop-2-enylperoxy)propyl] 2,2-dimethylbutanoate (PubChem CID 58715900) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylprop-2-enylperoxy)propyl] 2,2-dimethylbutanoate.
| Compound Name | [2,2-dimethyl-3-(2-methylprop-2-enylperoxy)propyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58715900 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylprop-2-enylperoxy)propyl] 2,2-dimethylbutanoate |
| SMILES | C=C(C)COOCC(C)(C)COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C15H28O4/c1-8-15(6,7)13(16)17-10-14(4,5)11-19-18-9-12(2)3/h2,8-11H2,1,3-7H3 |
| InChIKey | CINWZMXQTMNJRF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|