C14H24O5 — CID 59078170
[2-hydroxy-2-methyl-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylbutanoate (PubChem CID 59078170) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is [2-hydroxy-2-methyl-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylbutanoate.
| Compound Name | [2-hydroxy-2-methyl-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59078170 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [2-hydroxy-2-methyl-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylbutanoate |
| SMILES | C=C(C)C(=O)OCC(C)(O)COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C14H24O5/c1-7-13(4,5)12(16)19-9-14(6,17)8-18-11(15)10(2)3/h17H,2,7-9H2,1,3-6H3 |
| InChIKey | PPGXOPZPRGOOEK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|