C18H30O4 — CID 174553276
[2,4,4-trimethyl-2-(2-methylprop-2-enoyloxymethyl)hexyl] 2-methylprop-2-enoate (PubChem CID 174553276) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is [2,4,4-trimethyl-2-(2-methylprop-2-enoyloxymethyl)hexyl] 2-methylprop-2-enoate.
| Compound Name | [2,4,4-trimethyl-2-(2-methylprop-2-enoyloxymethyl)hexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174553276 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [2,4,4-trimethyl-2-(2-methylprop-2-enoyloxymethyl)hexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(COC(=O)C(=C)C)CC(C)(C)CC |
| InChI | InChI=1S/C18H30O4/c1-9-17(6,7)10-18(8,11-21-15(19)13(2)3)12-22-16(20)14(4)5/h2,4,9-12H2,1,3,5-8H3 |
| InChIKey | AOTAYTQHPMRNON-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|