C16H25NO7 — CID 58611640
2-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoacetyl]oxyethyl 2,2-dimethylbutanoate (PubChem CID 58611640) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoacetyl]oxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoacetyl]oxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58611640 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoacetyl]oxyethyl 2,2-dimethylbutanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)C(=O)OCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C16H25NO7/c1-6-16(4,5)15(21)24-10-9-23-14(20)12(18)17-7-8-22-13(19)11(2)3/h2,6-10H2,1,3-5H3,(H,17,18) |
| InChIKey | NTZXZVCXQVLMLT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|